C22H22N2O6S — CID 31138226
[2-[furan-2-ylmethyl(methyl)amino]-2-oxoethyl] 3-[(3-methylphenyl)sulfamoyl]benzoate (PubChem CID 31138226) has the molecular formula C22H22N2O6S and a molecular weight of 442.49 g/mol. Its IUPAC name is [2-[furan-2-ylmethyl(methyl)amino]-2-oxoethyl] 3-[(3-methylphenyl)sulfamoyl]benzoate.
| Compound Name | [2-[furan-2-ylmethyl(methyl)amino]-2-oxoethyl] 3-[(3-methylphenyl)sulfamoyl]benzoate |
|---|---|
| PubChem CID | 31138226 |
| Molecular Formula | C22H22N2O6S |
| Molecular Weight | 442.49 g/mol |
| Exact Mass | 442.12 |
| IUPAC Name | [2-[furan-2-ylmethyl(methyl)amino]-2-oxoethyl] 3-[(3-methylphenyl)sulfamoyl]benzoate |
| SMILES | Cc1cccc(NS(=O)(=O)c2cccc(C(=O)OCC(=O)N(C)Cc3ccco3)c2)c1 |
| InChI | InChI=1S/C22H22N2O6S/c1-16-6-3-8-18(12-16)23-31(27,28)20-10-4-7-17(13-20)22(26)30-15-21(25)24(2)14-19-9-5-11-29-19/h3-13,23H,14-15H2,1-2H3 |
| InChIKey | ADKZQFLHHPZGLD-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 105.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.49 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |