C18H22N2O6S — CID 9017755
[2-[methyl-[(5-methylfuran-2-yl)methyl]amino]-2-oxoethyl] 3-(dimethylsulfamoyl)benzoate (PubChem CID 9017755) has the molecular formula C18H22N2O6S and a molecular weight of 394.45 g/mol. Its IUPAC name is [2-[methyl-[(5-methylfuran-2-yl)methyl]amino]-2-oxoethyl] 3-(dimethylsulfamoyl)benzoate.
| Compound Name | [2-[methyl-[(5-methylfuran-2-yl)methyl]amino]-2-oxoethyl] 3-(dimethylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 9017755 |
| Molecular Formula | C18H22N2O6S |
| Molecular Weight | 394.45 g/mol |
| Exact Mass | 394.12 |
| IUPAC Name | [2-[methyl-[(5-methylfuran-2-yl)methyl]amino]-2-oxoethyl] 3-(dimethylsulfamoyl)benzoate |
| SMILES | Cc1ccc(CN(C)C(=O)COC(=O)c2cccc(S(=O)(=O)N(C)C)c2)o1 |
| InChI | InChI=1S/C18H22N2O6S/c1-13-8-9-15(26-13)11-20(4)17(21)12-25-18(22)14-6-5-7-16(10-14)27(23,24)19(2)3/h5-10H,11-12H2,1-4H3 |
| InChIKey | PUULQZLZSBQMHL-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 97.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.45 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |