C23H19NO7S — CID 55499402
[2-(1,3-benzodioxol-5-yl)-2-oxoethyl] 3-[(3-methylphenyl)sulfamoyl]benzoate (PubChem CID 55499402) has the molecular formula C23H19NO7S and a molecular weight of 453.47 g/mol. Its IUPAC name is [2-(1,3-benzodioxol-5-yl)-2-oxoethyl] 3-[(3-methylphenyl)sulfamoyl]benzoate.
| Compound Name | [2-(1,3-benzodioxol-5-yl)-2-oxoethyl] 3-[(3-methylphenyl)sulfamoyl]benzoate |
|---|---|
| PubChem CID | 55499402 |
| Molecular Formula | C23H19NO7S |
| Molecular Weight | 453.47 g/mol |
| Exact Mass | 453.09 |
| IUPAC Name | [2-(1,3-benzodioxol-5-yl)-2-oxoethyl] 3-[(3-methylphenyl)sulfamoyl]benzoate |
| SMILES | Cc1cccc(NS(=O)(=O)c2cccc(C(=O)OCC(=O)c3ccc4c(c3)OCO4)c2)c1 |
| InChI | InChI=1S/C23H19NO7S/c1-15-4-2-6-18(10-15)24-32(27,28)19-7-3-5-17(11-19)23(26)29-13-20(25)16-8-9-21-22(12-16)31-14-30-21/h2-12,24H,13-14H2,1H3 |
| InChIKey | CSSLBANQVAFFDV-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 108.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.47 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |