C24H19NO6S — CID 25041610
[2-(1-benzofuran-2-yl)-2-oxoethyl] 3-[(3-methylphenyl)sulfamoyl]benzoate (PubChem CID 25041610) has the molecular formula C24H19NO6S and a molecular weight of 449.48 g/mol. Its IUPAC name is [2-(1-benzofuran-2-yl)-2-oxoethyl] 3-[(3-methylphenyl)sulfamoyl]benzoate.
| Compound Name | [2-(1-benzofuran-2-yl)-2-oxoethyl] 3-[(3-methylphenyl)sulfamoyl]benzoate |
|---|---|
| PubChem CID | 25041610 |
| Molecular Formula | C24H19NO6S |
| Molecular Weight | 449.48 g/mol |
| Exact Mass | 449.09 |
| IUPAC Name | [2-(1-benzofuran-2-yl)-2-oxoethyl] 3-[(3-methylphenyl)sulfamoyl]benzoate |
| SMILES | Cc1cccc(NS(=O)(=O)c2cccc(C(=O)OCC(=O)c3cc4ccccc4o3)c2)c1 |
| InChI | InChI=1S/C24H19NO6S/c1-16-6-4-9-19(12-16)25-32(28,29)20-10-5-8-18(13-20)24(27)30-15-21(26)23-14-17-7-2-3-11-22(17)31-23/h2-14,25H,15H2,1H3 |
| InChIKey | IVUARRQUWGEPMR-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 102.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.48 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |