C18H17BrN2O7S — CID 30515965
[2-(ethoxycarbonylamino)-2-oxoethyl] 4-[(4-bromophenyl)sulfonylamino]benzoate (PubChem CID 30515965) has the molecular formula C18H17BrN2O7S and a molecular weight of 485.31 g/mol. Its IUPAC name is [2-(ethoxycarbonylamino)-2-oxoethyl] 4-[(4-bromophenyl)sulfonylamino]benzoate.
| Compound Name | [2-(ethoxycarbonylamino)-2-oxoethyl] 4-[(4-bromophenyl)sulfonylamino]benzoate |
|---|---|
| PubChem CID | 30515965 |
| Molecular Formula | C18H17BrN2O7S |
| Molecular Weight | 485.31 g/mol |
| Exact Mass | 483.99 |
| IUPAC Name | [2-(ethoxycarbonylamino)-2-oxoethyl] 4-[(4-bromophenyl)sulfonylamino]benzoate |
| SMILES | CCOC(=O)NC(=O)COC(=O)c1ccc(NS(=O)(=O)c2ccc(Br)cc2)cc1 |
| InChI | InChI=1S/C18H17BrN2O7S/c1-2-27-18(24)20-16(22)11-28-17(23)12-3-7-14(8-4-12)21-29(25,26)15-9-5-13(19)6-10-15/h3-10,21H,2,11H2,1H3,(H,20,22,24) |
| InChIKey | QITRWERNDOYWAJ-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 127.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.31 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |