C22H18BrNO6S — CID 2401848
[2-(4-methoxyphenyl)-2-oxoethyl] 4-[(4-bromophenyl)sulfonylamino]benzoate (PubChem CID 2401848) has the molecular formula C22H18BrNO6S and a molecular weight of 504.36 g/mol. Its IUPAC name is [2-(4-methoxyphenyl)-2-oxoethyl] 4-[(4-bromophenyl)sulfonylamino]benzoate.
| Compound Name | [2-(4-methoxyphenyl)-2-oxoethyl] 4-[(4-bromophenyl)sulfonylamino]benzoate |
|---|---|
| PubChem CID | 2401848 |
| Molecular Formula | C22H18BrNO6S |
| Molecular Weight | 504.36 g/mol |
| Exact Mass | 503.00 |
| IUPAC Name | [2-(4-methoxyphenyl)-2-oxoethyl] 4-[(4-bromophenyl)sulfonylamino]benzoate |
| SMILES | COc1ccc(C(=O)COC(=O)c2ccc(NS(=O)(=O)c3ccc(Br)cc3)cc2)cc1 |
| InChI | InChI=1S/C22H18BrNO6S/c1-29-19-10-4-15(5-11-19)21(25)14-30-22(26)16-2-8-18(9-3-16)24-31(27,28)20-12-6-17(23)7-13-20/h2-13,24H,14H2,1H3 |
| InChIKey | LLXMBJVTBPNQMZ-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.36 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |