C16H16N2O5S — CID 2511957
(2-amino-2-oxoethyl) 4-[(4-methylphenyl)sulfamoyl]benzoate (PubChem CID 2511957) has the molecular formula C16H16N2O5S and a molecular weight of 348.38 g/mol. Its IUPAC name is (2-amino-2-oxoethyl) 4-[(4-methylphenyl)sulfamoyl]benzoate.
| Compound Name | (2-amino-2-oxoethyl) 4-[(4-methylphenyl)sulfamoyl]benzoate |
|---|---|
| PubChem CID | 2511957 |
| Molecular Formula | C16H16N2O5S |
| Molecular Weight | 348.38 g/mol |
| Exact Mass | 348.08 |
| IUPAC Name | (2-amino-2-oxoethyl) 4-[(4-methylphenyl)sulfamoyl]benzoate |
| SMILES | Cc1ccc(NS(=O)(=O)c2ccc(C(=O)OCC(N)=O)cc2)cc1 |
| InChI | InChI=1S/C16H16N2O5S/c1-11-2-6-13(7-3-11)18-24(21,22)14-8-4-12(5-9-14)16(20)23-10-15(17)19/h2-9,18H,10H2,1H3,(H2,17,19) |
| InChIKey | AIDNUBFTJRLVQR-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 115.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.38 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |