C22H19NO5S — CID 46675318
phenacyl 4-[(4-methylphenyl)sulfamoyl]benzoate (PubChem CID 46675318) has the molecular formula C22H19NO5S and a molecular weight of 409.46 g/mol. Its IUPAC name is phenacyl 4-[(4-methylphenyl)sulfamoyl]benzoate.
| Compound Name | phenacyl 4-[(4-methylphenyl)sulfamoyl]benzoate |
|---|---|
| PubChem CID | 46675318 |
| Molecular Formula | C22H19NO5S |
| Molecular Weight | 409.46 g/mol |
| Exact Mass | 409.10 |
| IUPAC Name | phenacyl 4-[(4-methylphenyl)sulfamoyl]benzoate |
| SMILES | Cc1ccc(NS(=O)(=O)c2ccc(C(=O)OCC(=O)c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C22H19NO5S/c1-16-7-11-19(12-8-16)23-29(26,27)20-13-9-18(10-14-20)22(25)28-15-21(24)17-5-3-2-4-6-17/h2-14,23H,15H2,1H3 |
| InChIKey | IGDZOOVVVATVGN-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.46 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |