About [2-[4-[(4-methylphenyl)sulfonylamino]phenyl]-2-oxoethyl] 3-fluorobenzoate
[2-[4-[(4-methylphenyl)sulfonylamino]phenyl]-2-oxoethyl] 3-fluorobenzoate (PubChem CID 19132510) has the molecular formula C22H18FNO5S
and a molecular weight of 427.45 g/mol. Its IUPAC name is [2-[4-[(4-methylphenyl)sulfonylamino]phenyl]-2-oxoethyl] 3-fluorobenzoate.
Molecular Properties
| Compound Name | [2-[4-[(4-methylphenyl)sulfonylamino]phenyl]-2-oxoethyl] 3-fluorobenzoate |
| PubChem CID | 19132510 |
| Molecular Formula | C22H18FNO5S |
| Molecular Weight | 427.45 g/mol |
| Exact Mass | 427.09 |
| IUPAC Name | [2-[4-[(4-methylphenyl)sulfonylamino]phenyl]-2-oxoethyl] 3-fluorobenzoate |
| SMILES | Cc1ccc(S(=O)(=O)Nc2ccc(C(=O)COC(=O)c3cccc(F)c3)cc2)cc1 |
| InChI | InChI=1S/C22H18FNO5S/c1-15-5-11-20(12-6-15)30(27,28)24-19-9-7-16(8-10-19)21(25)14-29-22(26)17-3-2-4-18(23)13-17/h2-13,24H,14H2,1H3 |
| InChIKey | IVCKWQKYZSQBSD-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 427.45 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [2-[4-[(4-methylphenyl)sulfonylamino]phenyl]-2-oxoethyl] 3-fluorobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[4-[(4-methylphenyl)sulfonylamino]phenyl]-2-oxoethyl] 3-fluorobenzoate?
The IUPAC name of [2-[4-[(4-methylphenyl)sulfonylamino]phenyl]-2-oxoethyl] 3-fluorobenzoate (CID 19132510) is [2-[4-[(4-methylphenyl)sulfonylamino]phenyl]-2-oxoethyl] 3-fluorobenzoate.
What is the SMILES notation for [2-[4-[(4-methylphenyl)sulfonylamino]phenyl]-2-oxoethyl] 3-fluorobenzoate?
The canonical SMILES for [2-[4-[(4-methylphenyl)sulfonylamino]phenyl]-2-oxoethyl] 3-fluorobenzoate is Cc1ccc(S(=O)(=O)Nc2ccc(C(=O)COC(=O)c3cccc(F)c3)cc2)cc1.
What is the InChIKey of [2-[4-[(4-methylphenyl)sulfonylamino]phenyl]-2-oxoethyl] 3-fluorobenzoate?
The InChIKey is IVCKWQKYZSQBSD-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H18FNO5S/c1-15-5-11-20(12-6-15)30(27,28)24-19-9-7-16(8-10-19)21(25)14-29-22(26)17-3-2-4-18(23)13-17/h2-13,24H,14H2,1H3.
What are the key properties of [2-[4-[(4-methylphenyl)sulfonylamino]phenyl]-2-oxoethyl] 3-fluorobenzoate?
[2-[4-[(4-methylphenyl)sulfonylamino]phenyl]-2-oxoethyl] 3-fluorobenzoate has a molecular weight of 427.45 g/mol, XLogP of 3.97, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[4-[(4-methylphenyl)sulfonylamino]phenyl]-2-oxoethyl] 3-fluorobenzoate is sourced from PubChem (CID 19132510), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).