C21H16F2N2O5S — CID 2584096
[2-(3-fluoroanilino)-2-oxoethyl] 3-[(4-fluorophenyl)sulfamoyl]benzoate (PubChem CID 2584096) has the molecular formula C21H16F2N2O5S and a molecular weight of 446.43 g/mol. Its IUPAC name is [2-(3-fluoroanilino)-2-oxoethyl] 3-[(4-fluorophenyl)sulfamoyl]benzoate.
| Compound Name | [2-(3-fluoroanilino)-2-oxoethyl] 3-[(4-fluorophenyl)sulfamoyl]benzoate |
|---|---|
| PubChem CID | 2584096 |
| Molecular Formula | C21H16F2N2O5S |
| Molecular Weight | 446.43 g/mol |
| Exact Mass | 446.07 |
| IUPAC Name | [2-(3-fluoroanilino)-2-oxoethyl] 3-[(4-fluorophenyl)sulfamoyl]benzoate |
| SMILES | O=C(COC(=O)c1cccc(S(=O)(=O)Nc2ccc(F)cc2)c1)Nc1cccc(F)c1 |
| InChI | InChI=1S/C21H16F2N2O5S/c22-15-7-9-17(10-8-15)25-31(28,29)19-6-1-3-14(11-19)21(27)30-13-20(26)24-18-5-2-4-16(23)12-18/h1-12,25H,13H2,(H,24,26) |
| InChIKey | MBUPNVGKMDDPDD-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.43 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |