C25H25FN2O5S — CID 42967832
[2-oxo-2-(4-phenylbutan-2-ylamino)ethyl] 3-[(4-fluorophenyl)sulfamoyl]benzoate (PubChem CID 42967832) has the molecular formula C25H25FN2O5S and a molecular weight of 484.55 g/mol. Its IUPAC name is [2-oxo-2-(4-phenylbutan-2-ylamino)ethyl] 3-[(4-fluorophenyl)sulfamoyl]benzoate.
| Compound Name | [2-oxo-2-(4-phenylbutan-2-ylamino)ethyl] 3-[(4-fluorophenyl)sulfamoyl]benzoate |
|---|---|
| PubChem CID | 42967832 |
| Molecular Formula | C25H25FN2O5S |
| Molecular Weight | 484.55 g/mol |
| Exact Mass | 484.15 |
| IUPAC Name | [2-oxo-2-(4-phenylbutan-2-ylamino)ethyl] 3-[(4-fluorophenyl)sulfamoyl]benzoate |
| SMILES | CC(CCc1ccccc1)NC(=O)COC(=O)c1cccc(S(=O)(=O)Nc2ccc(F)cc2)c1 |
| InChI | InChI=1S/C25H25FN2O5S/c1-18(10-11-19-6-3-2-4-7-19)27-24(29)17-33-25(30)20-8-5-9-23(16-20)34(31,32)28-22-14-12-21(26)13-15-22/h2-9,12-16,18,28H,10-11,17H2,1H3,(H,27,29) |
| InChIKey | HHOPGOSFIVHCHY-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.55 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |