C25H23FN2O5S — CID 55524851
[2-[[cyclopropyl(phenyl)methyl]amino]-2-oxoethyl] 3-[(4-fluorophenyl)sulfamoyl]benzoate (PubChem CID 55524851) has the molecular formula C25H23FN2O5S and a molecular weight of 482.53 g/mol. Its IUPAC name is [2-[[cyclopropyl(phenyl)methyl]amino]-2-oxoethyl] 3-[(4-fluorophenyl)sulfamoyl]benzoate.
| Compound Name | [2-[[cyclopropyl(phenyl)methyl]amino]-2-oxoethyl] 3-[(4-fluorophenyl)sulfamoyl]benzoate |
|---|---|
| PubChem CID | 55524851 |
| Molecular Formula | C25H23FN2O5S |
| Molecular Weight | 482.53 g/mol |
| Exact Mass | 482.13 |
| IUPAC Name | [2-[[cyclopropyl(phenyl)methyl]amino]-2-oxoethyl] 3-[(4-fluorophenyl)sulfamoyl]benzoate |
| SMILES | O=C(COC(=O)c1cccc(S(=O)(=O)Nc2ccc(F)cc2)c1)NC(c1ccccc1)C1CC1 |
| InChI | InChI=1S/C25H23FN2O5S/c26-20-11-13-21(14-12-20)28-34(31,32)22-8-4-7-19(15-22)25(30)33-16-23(29)27-24(18-9-10-18)17-5-2-1-3-6-17/h1-8,11-15,18,24,28H,9-10,16H2,(H,27,29) |
| InChIKey | IZZVVIQVHNNNHX-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.53 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |