C22H18ClFN2O5S — CID 2584207
[2-[(4-chlorophenyl)methylamino]-2-oxoethyl] 3-[(4-fluorophenyl)sulfamoyl]benzoate (PubChem CID 2584207) has the molecular formula C22H18ClFN2O5S and a molecular weight of 476.91 g/mol. Its IUPAC name is [2-[(4-chlorophenyl)methylamino]-2-oxoethyl] 3-[(4-fluorophenyl)sulfamoyl]benzoate.
| Compound Name | [2-[(4-chlorophenyl)methylamino]-2-oxoethyl] 3-[(4-fluorophenyl)sulfamoyl]benzoate |
|---|---|
| PubChem CID | 2584207 |
| Molecular Formula | C22H18ClFN2O5S |
| Molecular Weight | 476.91 g/mol |
| Exact Mass | 476.06 |
| IUPAC Name | [2-[(4-chlorophenyl)methylamino]-2-oxoethyl] 3-[(4-fluorophenyl)sulfamoyl]benzoate |
| SMILES | O=C(COC(=O)c1cccc(S(=O)(=O)Nc2ccc(F)cc2)c1)NCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H18ClFN2O5S/c23-17-6-4-15(5-7-17)13-25-21(27)14-31-22(28)16-2-1-3-20(12-16)32(29,30)26-19-10-8-18(24)9-11-19/h1-12,26H,13-14H2,(H,25,27) |
| InChIKey | FOJFRTJUBXWRTR-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.91 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |