C23H21FN2O6S — CID 29183951
[2-[(3-methoxyphenyl)methylamino]-2-oxoethyl] 3-[(4-fluorophenyl)sulfamoyl]benzoate (PubChem CID 29183951) has the molecular formula C23H21FN2O6S and a molecular weight of 472.49 g/mol. Its IUPAC name is [2-[(3-methoxyphenyl)methylamino]-2-oxoethyl] 3-[(4-fluorophenyl)sulfamoyl]benzoate.
| Compound Name | [2-[(3-methoxyphenyl)methylamino]-2-oxoethyl] 3-[(4-fluorophenyl)sulfamoyl]benzoate |
|---|---|
| PubChem CID | 29183951 |
| Molecular Formula | C23H21FN2O6S |
| Molecular Weight | 472.49 g/mol |
| Exact Mass | 472.11 |
| IUPAC Name | [2-[(3-methoxyphenyl)methylamino]-2-oxoethyl] 3-[(4-fluorophenyl)sulfamoyl]benzoate |
| SMILES | COc1cccc(CNC(=O)COC(=O)c2cccc(S(=O)(=O)Nc3ccc(F)cc3)c2)c1 |
| InChI | InChI=1S/C23H21FN2O6S/c1-31-20-6-2-4-16(12-20)14-25-22(27)15-32-23(28)17-5-3-7-21(13-17)33(29,30)26-19-10-8-18(24)9-11-19/h2-13,26H,14-15H2,1H3,(H,25,27) |
| InChIKey | IDXWEEABCKDYFY-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.49 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |