C24H23FN2O5S — CID 2623650
[2-oxo-2-(3-phenylpropylamino)ethyl] 3-[(4-fluorophenyl)sulfamoyl]benzoate (PubChem CID 2623650) has the molecular formula C24H23FN2O5S and a molecular weight of 470.52 g/mol. Its IUPAC name is [2-oxo-2-(3-phenylpropylamino)ethyl] 3-[(4-fluorophenyl)sulfamoyl]benzoate.
| Compound Name | [2-oxo-2-(3-phenylpropylamino)ethyl] 3-[(4-fluorophenyl)sulfamoyl]benzoate |
|---|---|
| PubChem CID | 2623650 |
| Molecular Formula | C24H23FN2O5S |
| Molecular Weight | 470.52 g/mol |
| Exact Mass | 470.13 |
| IUPAC Name | [2-oxo-2-(3-phenylpropylamino)ethyl] 3-[(4-fluorophenyl)sulfamoyl]benzoate |
| SMILES | O=C(COC(=O)c1cccc(S(=O)(=O)Nc2ccc(F)cc2)c1)NCCCc1ccccc1 |
| InChI | InChI=1S/C24H23FN2O5S/c25-20-11-13-21(14-12-20)27-33(30,31)22-10-4-9-19(16-22)24(29)32-17-23(28)26-15-5-8-18-6-2-1-3-7-18/h1-4,6-7,9-14,16,27H,5,8,15,17H2,(H,26,28) |
| InChIKey | PXJKTKMWGVBRRX-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.52 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|