C21H22N2O5S — CID 38851740
[2-oxo-2-(3-phenylpropylamino)ethyl] 3-(prop-2-ynylsulfamoyl)benzoate (PubChem CID 38851740) has the molecular formula C21H22N2O5S and a molecular weight of 414.48 g/mol. Its IUPAC name is [2-oxo-2-(3-phenylpropylamino)ethyl] 3-(prop-2-ynylsulfamoyl)benzoate.
| Compound Name | [2-oxo-2-(3-phenylpropylamino)ethyl] 3-(prop-2-ynylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 38851740 |
| Molecular Formula | C21H22N2O5S |
| Molecular Weight | 414.48 g/mol |
| Exact Mass | 414.12 |
| IUPAC Name | [2-oxo-2-(3-phenylpropylamino)ethyl] 3-(prop-2-ynylsulfamoyl)benzoate |
| SMILES | C#CCNS(=O)(=O)c1cccc(C(=O)OCC(=O)NCCCc2ccccc2)c1 |
| InChI | InChI=1S/C21H22N2O5S/c1-2-13-23-29(26,27)19-12-6-11-18(15-19)21(25)28-16-20(24)22-14-7-10-17-8-4-3-5-9-17/h1,3-6,8-9,11-12,15,23H,7,10,13-14,16H2,(H,22,24) |
| InChIKey | OCVDSKDYKRJKOH-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.48 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|