C20H23NO4 — CID 33408284
[2-oxo-2-(3-phenylpropylamino)ethyl] 3-(methoxymethyl)benzoate (PubChem CID 33408284) has the molecular formula C20H23NO4 and a molecular weight of 341.41 g/mol. Its IUPAC name is [2-oxo-2-(3-phenylpropylamino)ethyl] 3-(methoxymethyl)benzoate.
| Compound Name | [2-oxo-2-(3-phenylpropylamino)ethyl] 3-(methoxymethyl)benzoate |
|---|---|
| PubChem CID | 33408284 |
| Molecular Formula | C20H23NO4 |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.16 |
| IUPAC Name | [2-oxo-2-(3-phenylpropylamino)ethyl] 3-(methoxymethyl)benzoate |
| SMILES | COCc1cccc(C(=O)OCC(=O)NCCCc2ccccc2)c1 |
| InChI | InChI=1S/C20H23NO4/c1-24-14-17-9-5-11-18(13-17)20(23)25-15-19(22)21-12-6-10-16-7-3-2-4-8-16/h2-5,7-9,11,13H,6,10,12,14-15H2,1H3,(H,21,22) |
| InChIKey | PIOJCSRYDVPGNZ-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|