C18H18ClNO3 — CID 2504142
[2-oxo-2-(3-phenylpropylamino)ethyl] 3-chlorobenzoate (PubChem CID 2504142) has the molecular formula C18H18ClNO3 and a molecular weight of 331.80 g/mol. Its IUPAC name is [2-oxo-2-(3-phenylpropylamino)ethyl] 3-chlorobenzoate.
| Compound Name | [2-oxo-2-(3-phenylpropylamino)ethyl] 3-chlorobenzoate |
|---|---|
| PubChem CID | 2504142 |
| Molecular Formula | C18H18ClNO3 |
| Molecular Weight | 331.80 g/mol |
| Exact Mass | 331.10 |
| IUPAC Name | [2-oxo-2-(3-phenylpropylamino)ethyl] 3-chlorobenzoate |
| SMILES | O=C(COC(=O)c1cccc(Cl)c1)NCCCc1ccccc1 |
| InChI | InChI=1S/C18H18ClNO3/c19-16-10-4-9-15(12-16)18(22)23-13-17(21)20-11-5-8-14-6-2-1-3-7-14/h1-4,6-7,9-10,12H,5,8,11,13H2,(H,20,21) |
| InChIKey | ZBAZMUHLVNSKEA-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.80 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|