C18H18BrNO3 — CID 2624058
[2-oxo-2-(3-phenylpropylamino)ethyl] 2-bromobenzoate (PubChem CID 2624058) has the molecular formula C18H18BrNO3 and a molecular weight of 376.25 g/mol. Its IUPAC name is [2-oxo-2-(3-phenylpropylamino)ethyl] 2-bromobenzoate.
| Compound Name | [2-oxo-2-(3-phenylpropylamino)ethyl] 2-bromobenzoate |
|---|---|
| PubChem CID | 2624058 |
| Molecular Formula | C18H18BrNO3 |
| Molecular Weight | 376.25 g/mol |
| Exact Mass | 375.05 |
| IUPAC Name | [2-oxo-2-(3-phenylpropylamino)ethyl] 2-bromobenzoate |
| SMILES | O=C(COC(=O)c1ccccc1Br)NCCCc1ccccc1 |
| InChI | InChI=1S/C18H18BrNO3/c19-16-11-5-4-10-15(16)18(22)23-13-17(21)20-12-6-9-14-7-2-1-3-8-14/h1-5,7-8,10-11H,6,9,12-13H2,(H,20,21) |
| InChIKey | QZDOVICQRXSCSI-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.25 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|