C20H23NO4S — CID 46815543
[2-oxo-2-(3-phenylpropylamino)ethyl] 2-ethylsulfinylbenzoate (PubChem CID 46815543) has the molecular formula C20H23NO4S and a molecular weight of 373.47 g/mol. Its IUPAC name is [2-oxo-2-(3-phenylpropylamino)ethyl] 2-ethylsulfinylbenzoate.
| Compound Name | [2-oxo-2-(3-phenylpropylamino)ethyl] 2-ethylsulfinylbenzoate |
|---|---|
| PubChem CID | 46815543 |
| Molecular Formula | C20H23NO4S |
| Molecular Weight | 373.47 g/mol |
| Exact Mass | 373.13 |
| IUPAC Name | [2-oxo-2-(3-phenylpropylamino)ethyl] 2-ethylsulfinylbenzoate |
| SMILES | CCS(=O)c1ccccc1C(=O)OCC(=O)NCCCc1ccccc1 |
| InChI | InChI=1S/C20H23NO4S/c1-2-26(24)18-13-7-6-12-17(18)20(23)25-15-19(22)21-14-8-11-16-9-4-3-5-10-16/h3-7,9-10,12-13H,2,8,11,14-15H2,1H3,(H,21,22) |
| InChIKey | VUSJXSFWWBMEGK-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.47 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|