C19H20ClNO4S — CID 11926455
[2-[2-(3-chlorophenyl)ethylamino]-2-oxoethyl] 2-[(S)-ethylsulfinyl]benzoate (PubChem CID 11926455) has the molecular formula C19H20ClNO4S and a molecular weight of 393.89 g/mol. Its IUPAC name is [2-[2-(3-chlorophenyl)ethylamino]-2-oxoethyl] 2-[(S)-ethylsulfinyl]benzoate.
| Compound Name | [2-[2-(3-chlorophenyl)ethylamino]-2-oxoethyl] 2-[(S)-ethylsulfinyl]benzoate |
|---|---|
| PubChem CID | 11926455 |
| Molecular Formula | C19H20ClNO4S |
| Molecular Weight | 393.89 g/mol |
| Exact Mass | 393.08 |
| IUPAC Name | [2-[2-(3-chlorophenyl)ethylamino]-2-oxoethyl] 2-[(S)-ethylsulfinyl]benzoate |
| SMILES | CC[S@](=O)c1ccccc1C(=O)OCC(=O)NCCc1cccc(Cl)c1 |
| InChI | InChI=1S/C19H20ClNO4S/c1-2-26(24)17-9-4-3-8-16(17)19(23)25-13-18(22)21-11-10-14-6-5-7-15(20)12-14/h3-9,12H,2,10-11,13H2,1H3,(H,21,22)/t26-/m0/s1 |
| InChIKey | DHDRHTDZKXSQNN-SANMLTNESA-N |
| XLogP | 2.98 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.89 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |