About [3-[(2-ethylsulfinylbenzoyl)oxymethyl]phenyl]methyl 2-ethylsulfinylbenzoate
[3-[(2-ethylsulfinylbenzoyl)oxymethyl]phenyl]methyl 2-ethylsulfinylbenzoate (PubChem CID 55374801) has the molecular formula C26H26O6S2
and a molecular weight of 498.62 g/mol. Its IUPAC name is [3-[(2-ethylsulfinylbenzoyl)oxymethyl]phenyl]methyl 2-ethylsulfinylbenzoate.
Molecular Properties
| Compound Name | [3-[(2-ethylsulfinylbenzoyl)oxymethyl]phenyl]methyl 2-ethylsulfinylbenzoate |
| PubChem CID | 55374801 |
| Molecular Formula | C26H26O6S2 |
| Molecular Weight | 498.62 g/mol |
| Exact Mass | 498.12 |
| IUPAC Name | [3-[(2-ethylsulfinylbenzoyl)oxymethyl]phenyl]methyl 2-ethylsulfinylbenzoate |
| SMILES | CCS(=O)c1ccccc1C(=O)OCc1cccc(COC(=O)c2ccccc2S(=O)CC)c1 |
| InChI | InChI=1S/C26H26O6S2/c1-3-33(29)23-14-7-5-12-21(23)25(27)31-17-19-10-9-11-20(16-19)18-32-26(28)22-13-6-8-15-24(22)34(30)4-2/h5-16H,3-4,17-18H2,1-2H3 |
| InChIKey | NYXCCSNEHNJJJZ-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 498.62 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [3-[(2-ethylsulfinylbenzoyl)oxymethyl]phenyl]methyl 2-ethylsulfinylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-[(2-ethylsulfinylbenzoyl)oxymethyl]phenyl]methyl 2-ethylsulfinylbenzoate?
The IUPAC name of [3-[(2-ethylsulfinylbenzoyl)oxymethyl]phenyl]methyl 2-ethylsulfinylbenzoate (CID 55374801) is [3-[(2-ethylsulfinylbenzoyl)oxymethyl]phenyl]methyl 2-ethylsulfinylbenzoate.
What is the SMILES notation for [3-[(2-ethylsulfinylbenzoyl)oxymethyl]phenyl]methyl 2-ethylsulfinylbenzoate?
The canonical SMILES for [3-[(2-ethylsulfinylbenzoyl)oxymethyl]phenyl]methyl 2-ethylsulfinylbenzoate is CCS(=O)c1ccccc1C(=O)OCc1cccc(COC(=O)c2ccccc2S(=O)CC)c1.
What is the InChIKey of [3-[(2-ethylsulfinylbenzoyl)oxymethyl]phenyl]methyl 2-ethylsulfinylbenzoate?
The InChIKey is NYXCCSNEHNJJJZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H26O6S2/c1-3-33(29)23-14-7-5-12-21(23)25(27)31-17-19-10-9-11-20(16-19)18-32-26(28)22-13-6-8-15-24(22)34(30)4-2/h5-16H,3-4,17-18H2,1-2H3.
What are the key properties of [3-[(2-ethylsulfinylbenzoyl)oxymethyl]phenyl]methyl 2-ethylsulfinylbenzoate?
[3-[(2-ethylsulfinylbenzoyl)oxymethyl]phenyl]methyl 2-ethylsulfinylbenzoate has a molecular weight of 498.62 g/mol, XLogP of 4.66, 10 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [3-[(2-ethylsulfinylbenzoyl)oxymethyl]phenyl]methyl 2-ethylsulfinylbenzoate is sourced from PubChem (CID 55374801), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).