C14H15NO4S — CID 75524884
(3-methyl-1,2-oxazol-5-yl)methyl 2-ethylsulfinylbenzoate (PubChem CID 75524884) has the molecular formula C14H15NO4S and a molecular weight of 293.34 g/mol. Its IUPAC name is (3-methyl-1,2-oxazol-5-yl)methyl 2-ethylsulfinylbenzoate.
| Compound Name | (3-methyl-1,2-oxazol-5-yl)methyl 2-ethylsulfinylbenzoate |
|---|---|
| PubChem CID | 75524884 |
| Molecular Formula | C14H15NO4S |
| Molecular Weight | 293.34 g/mol |
| Exact Mass | 293.07 |
| IUPAC Name | (3-methyl-1,2-oxazol-5-yl)methyl 2-ethylsulfinylbenzoate |
| SMILES | CCS(=O)c1ccccc1C(=O)OCc1cc(C)no1 |
| InChI | InChI=1S/C14H15NO4S/c1-3-20(17)13-7-5-4-6-12(13)14(16)18-9-11-8-10(2)15-19-11/h4-8H,3,9H2,1-2H3 |
| InChIKey | YGRMJGJLWLQJNW-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 69.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.34 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |