(3-methyl-1,2-oxazol-5-yl)methyl 2-(4-chlorobenzoyl)benzoate

C19H14ClNO4 — CID 18098467

IUPAC(3-methyl-1,2-oxazol-5-yl)methyl 2-(4-chlorobenzoyl)benzoate
SMILESCc1cc(COC(=O)c2ccccc2C(=O)c2ccc(Cl)cc2)on1
InChIInChI=1S/C19H14ClNO4/c1-12-10-15(25-21-12)11-24-19(23)17-5-3-2-4-16(17)18(22)13-6-8-14(20)9-7-13/h2-10H,11H2,1H3
InChIKeyGNXQUIYTMFEQOT-UHFFFAOYSA-N
MW355.78 g/mol
LogP4.22
Rot. Bonds5

About (3-methyl-1,2-oxazol-5-yl)methyl 2-(4-chlorobenzoyl)benzoate

(3-methyl-1,2-oxazol-5-yl)methyl 2-(4-chlorobenzoyl)benzoate (PubChem CID 18098467) has the molecular formula C19H14ClNO4 and a molecular weight of 355.78 g/mol. Its IUPAC name is (3-methyl-1,2-oxazol-5-yl)methyl 2-(4-chlorobenzoyl)benzoate.

Molecular Properties

Compound Name(3-methyl-1,2-oxazol-5-yl)methyl 2-(4-chlorobenzoyl)benzoate
PubChem CID18098467
Molecular FormulaC19H14ClNO4
Molecular Weight355.78 g/mol
Exact Mass355.06
IUPAC Name(3-methyl-1,2-oxazol-5-yl)methyl 2-(4-chlorobenzoyl)benzoate
SMILESCc1cc(COC(=O)c2ccccc2C(=O)c2ccc(Cl)cc2)on1
InChIInChI=1S/C19H14ClNO4/c1-12-10-15(25-21-12)11-24-19(23)17-5-3-2-4-16(17)18(22)13-6-8-14(20)9-7-13/h2-10H,11H2,1H3
InChIKeyGNXQUIYTMFEQOT-UHFFFAOYSA-N
XLogP4.22
TPSA69.40 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds5
Heavy Atoms25
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500355.78
LogP ≤ 54.22
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Analyze (3-methyl-1,2-oxazol-5-yl)methyl 2-(4-chlorobenzoyl)benzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (3-methyl-1,2-oxazol-5-yl)methyl 2-(4-chlorobenzoyl)benzoate?
The IUPAC name of (3-methyl-1,2-oxazol-5-yl)methyl 2-(4-chlorobenzoyl)benzoate (CID 18098467) is (3-methyl-1,2-oxazol-5-yl)methyl 2-(4-chlorobenzoyl)benzoate.
What is the SMILES notation for (3-methyl-1,2-oxazol-5-yl)methyl 2-(4-chlorobenzoyl)benzoate?
The canonical SMILES for (3-methyl-1,2-oxazol-5-yl)methyl 2-(4-chlorobenzoyl)benzoate is Cc1cc(COC(=O)c2ccccc2C(=O)c2ccc(Cl)cc2)on1.
What is the InChIKey of (3-methyl-1,2-oxazol-5-yl)methyl 2-(4-chlorobenzoyl)benzoate?
The InChIKey is GNXQUIYTMFEQOT-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H14ClNO4/c1-12-10-15(25-21-12)11-24-19(23)17-5-3-2-4-16(17)18(22)13-6-8-14(20)9-7-13/h2-10H,11H2,1H3.
What are the key properties of (3-methyl-1,2-oxazol-5-yl)methyl 2-(4-chlorobenzoyl)benzoate?
(3-methyl-1,2-oxazol-5-yl)methyl 2-(4-chlorobenzoyl)benzoate has a molecular weight of 355.78 g/mol, XLogP of 4.22, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (3-methyl-1,2-oxazol-5-yl)methyl 2-(4-chlorobenzoyl)benzoate is sourced from PubChem (CID 18098467), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).