C23H19ClO3 — CID 7891565
(2,5-dimethylphenyl)methyl 2-(4-chlorobenzoyl)benzoate (PubChem CID 7891565) has the molecular formula C23H19ClO3 and a molecular weight of 378.86 g/mol. Its IUPAC name is (2,5-dimethylphenyl)methyl 2-(4-chlorobenzoyl)benzoate.
| Compound Name | (2,5-dimethylphenyl)methyl 2-(4-chlorobenzoyl)benzoate |
|---|---|
| PubChem CID | 7891565 |
| Molecular Formula | C23H19ClO3 |
| Molecular Weight | 378.86 g/mol |
| Exact Mass | 378.10 |
| IUPAC Name | (2,5-dimethylphenyl)methyl 2-(4-chlorobenzoyl)benzoate |
| SMILES | Cc1ccc(C)c(COC(=O)c2ccccc2C(=O)c2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C23H19ClO3/c1-15-7-8-16(2)18(13-15)14-27-23(26)21-6-4-3-5-20(21)22(25)17-9-11-19(24)12-10-17/h3-13H,14H2,1-2H3 |
| InChIKey | IDDYFRAEGFQOLX-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.86 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |