C16H16FNO2 — CID 62681353
(2,5-dimethylphenyl)methyl 4-amino-3-fluorobenzoate (PubChem CID 62681353) has the molecular formula C16H16FNO2 and a molecular weight of 273.31 g/mol. Its IUPAC name is (2,5-dimethylphenyl)methyl 4-amino-3-fluorobenzoate.
| Compound Name | (2,5-dimethylphenyl)methyl 4-amino-3-fluorobenzoate |
|---|---|
| PubChem CID | 62681353 |
| Molecular Formula | C16H16FNO2 |
| Molecular Weight | 273.31 g/mol |
| Exact Mass | 273.12 |
| IUPAC Name | (2,5-dimethylphenyl)methyl 4-amino-3-fluorobenzoate |
| SMILES | Cc1ccc(C)c(COC(=O)c2ccc(N)c(F)c2)c1 |
| InChI | InChI=1S/C16H16FNO2/c1-10-3-4-11(2)13(7-10)9-20-16(19)12-5-6-15(18)14(17)8-12/h3-8H,9,18H2,1-2H3 |
| InChIKey | DWDIFOJDBWEQGE-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.31 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|