About (4-fluorophenyl)methyl 4-amino-3-fluorobenzoate
(4-fluorophenyl)methyl 4-amino-3-fluorobenzoate (PubChem CID 62682624) has the molecular formula C14H11F2NO2
and a molecular weight of 263.24 g/mol. Its IUPAC name is (4-fluorophenyl)methyl 4-amino-3-fluorobenzoate.
Molecular Properties
| Compound Name | (4-fluorophenyl)methyl 4-amino-3-fluorobenzoate |
| PubChem CID | 62682624 |
| Molecular Formula | C14H11F2NO2 |
| Molecular Weight | 263.24 g/mol |
| Exact Mass | 263.08 |
| IUPAC Name | (4-fluorophenyl)methyl 4-amino-3-fluorobenzoate |
| SMILES | Nc1ccc(C(=O)OCc2ccc(F)cc2)cc1F |
| InChI | InChI=1S/C14H11F2NO2/c15-11-4-1-9(2-5-11)8-19-14(18)10-3-6-13(17)12(16)7-10/h1-7H,8,17H2 |
| InChIKey | OZCZPBJRDACNOI-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.24 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze (4-fluorophenyl)methyl 4-amino-3-fluorobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-fluorophenyl)methyl 4-amino-3-fluorobenzoate?
The IUPAC name of (4-fluorophenyl)methyl 4-amino-3-fluorobenzoate (CID 62682624) is (4-fluorophenyl)methyl 4-amino-3-fluorobenzoate.
What is the SMILES notation for (4-fluorophenyl)methyl 4-amino-3-fluorobenzoate?
The canonical SMILES for (4-fluorophenyl)methyl 4-amino-3-fluorobenzoate is Nc1ccc(C(=O)OCc2ccc(F)cc2)cc1F.
What is the InChIKey of (4-fluorophenyl)methyl 4-amino-3-fluorobenzoate?
The InChIKey is OZCZPBJRDACNOI-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11F2NO2/c15-11-4-1-9(2-5-11)8-19-14(18)10-3-6-13(17)12(16)7-10/h1-7H,8,17H2.
What are the key properties of (4-fluorophenyl)methyl 4-amino-3-fluorobenzoate?
(4-fluorophenyl)methyl 4-amino-3-fluorobenzoate has a molecular weight of 263.24 g/mol, XLogP of 2.90, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4-fluorophenyl)methyl 4-amino-3-fluorobenzoate is sourced from PubChem (CID 62682624), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).