About (4-bromo-3-fluorophenyl)methyl 4-bromo-3-fluorobenzoate
(4-bromo-3-fluorophenyl)methyl 4-bromo-3-fluorobenzoate (PubChem CID 70164976) has the molecular formula C14H8Br2F2O2
and a molecular weight of 406.02 g/mol. Its IUPAC name is (4-bromo-3-fluorophenyl)methyl 4-bromo-3-fluorobenzoate.
Molecular Properties
| Compound Name | (4-bromo-3-fluorophenyl)methyl 4-bromo-3-fluorobenzoate |
| PubChem CID | 70164976 |
| Molecular Formula | C14H8Br2F2O2 |
| Molecular Weight | 406.02 g/mol |
| Exact Mass | 403.89 |
| IUPAC Name | (4-bromo-3-fluorophenyl)methyl 4-bromo-3-fluorobenzoate |
| SMILES | O=C(OCc1ccc(Br)c(F)c1)c1ccc(Br)c(F)c1 |
| InChI | InChI=1S/C14H8Br2F2O2/c15-10-3-1-8(5-12(10)17)7-20-14(19)9-2-4-11(16)13(18)6-9/h1-6H,7H2 |
| InChIKey | NJWZPDVDQFGEJI-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 406.02 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (4-bromo-3-fluorophenyl)methyl 4-bromo-3-fluorobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-bromo-3-fluorophenyl)methyl 4-bromo-3-fluorobenzoate?
The IUPAC name of (4-bromo-3-fluorophenyl)methyl 4-bromo-3-fluorobenzoate (CID 70164976) is (4-bromo-3-fluorophenyl)methyl 4-bromo-3-fluorobenzoate.
What is the SMILES notation for (4-bromo-3-fluorophenyl)methyl 4-bromo-3-fluorobenzoate?
The canonical SMILES for (4-bromo-3-fluorophenyl)methyl 4-bromo-3-fluorobenzoate is O=C(OCc1ccc(Br)c(F)c1)c1ccc(Br)c(F)c1.
What is the InChIKey of (4-bromo-3-fluorophenyl)methyl 4-bromo-3-fluorobenzoate?
The InChIKey is NJWZPDVDQFGEJI-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H8Br2F2O2/c15-10-3-1-8(5-12(10)17)7-20-14(19)9-2-4-11(16)13(18)6-9/h1-6H,7H2.
What are the key properties of (4-bromo-3-fluorophenyl)methyl 4-bromo-3-fluorobenzoate?
(4-bromo-3-fluorophenyl)methyl 4-bromo-3-fluorobenzoate has a molecular weight of 406.02 g/mol, XLogP of 4.85, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4-bromo-3-fluorophenyl)methyl 4-bromo-3-fluorobenzoate is sourced from PubChem (CID 70164976), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).