About (3-bromo-4-fluorophenyl)methyl 3-aminobenzoate
(3-bromo-4-fluorophenyl)methyl 3-aminobenzoate (PubChem CID 61238364) has the molecular formula C14H11BrFNO2
and a molecular weight of 324.15 g/mol. Its IUPAC name is (3-bromo-4-fluorophenyl)methyl 3-aminobenzoate.
Molecular Properties
| Compound Name | (3-bromo-4-fluorophenyl)methyl 3-aminobenzoate |
| PubChem CID | 61238364 |
| Molecular Formula | C14H11BrFNO2 |
| Molecular Weight | 324.15 g/mol |
| Exact Mass | 323.00 |
| IUPAC Name | (3-bromo-4-fluorophenyl)methyl 3-aminobenzoate |
| SMILES | Nc1cccc(C(=O)OCc2ccc(F)c(Br)c2)c1 |
| InChI | InChI=1S/C14H11BrFNO2/c15-12-6-9(4-5-13(12)16)8-19-14(18)10-2-1-3-11(17)7-10/h1-7H,8,17H2 |
| InChIKey | QNIAROOYXFFQOI-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.15 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze (3-bromo-4-fluorophenyl)methyl 3-aminobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-bromo-4-fluorophenyl)methyl 3-aminobenzoate?
The IUPAC name of (3-bromo-4-fluorophenyl)methyl 3-aminobenzoate (CID 61238364) is (3-bromo-4-fluorophenyl)methyl 3-aminobenzoate.
What is the SMILES notation for (3-bromo-4-fluorophenyl)methyl 3-aminobenzoate?
The canonical SMILES for (3-bromo-4-fluorophenyl)methyl 3-aminobenzoate is Nc1cccc(C(=O)OCc2ccc(F)c(Br)c2)c1.
What is the InChIKey of (3-bromo-4-fluorophenyl)methyl 3-aminobenzoate?
The InChIKey is QNIAROOYXFFQOI-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11BrFNO2/c15-12-6-9(4-5-13(12)16)8-19-14(18)10-2-1-3-11(17)7-10/h1-7H,8,17H2.
What are the key properties of (3-bromo-4-fluorophenyl)methyl 3-aminobenzoate?
(3-bromo-4-fluorophenyl)methyl 3-aminobenzoate has a molecular weight of 324.15 g/mol, XLogP of 3.53, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3-bromo-4-fluorophenyl)methyl 3-aminobenzoate is sourced from PubChem (CID 61238364), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).