About (3-cyano-4-fluorophenyl)methyl 5-amino-2-bromobenzoate
(3-cyano-4-fluorophenyl)methyl 5-amino-2-bromobenzoate (PubChem CID 103827129) has the molecular formula C15H10BrFN2O2
and a molecular weight of 349.16 g/mol. Its IUPAC name is (3-cyano-4-fluorophenyl)methyl 5-amino-2-bromobenzoate.
Molecular Properties
| Compound Name | (3-cyano-4-fluorophenyl)methyl 5-amino-2-bromobenzoate |
| PubChem CID | 103827129 |
| Molecular Formula | C15H10BrFN2O2 |
| Molecular Weight | 349.16 g/mol |
| Exact Mass | 347.99 |
| IUPAC Name | (3-cyano-4-fluorophenyl)methyl 5-amino-2-bromobenzoate |
| SMILES | N#Cc1cc(COC(=O)c2cc(N)ccc2Br)ccc1F |
| InChI | InChI=1S/C15H10BrFN2O2/c16-13-3-2-11(19)6-12(13)15(20)21-8-9-1-4-14(17)10(5-9)7-18/h1-6H,8,19H2 |
| InChIKey | YNWXSYWSXLKZKQ-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 76.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.16 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze (3-cyano-4-fluorophenyl)methyl 5-amino-2-bromobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-cyano-4-fluorophenyl)methyl 5-amino-2-bromobenzoate?
The IUPAC name of (3-cyano-4-fluorophenyl)methyl 5-amino-2-bromobenzoate (CID 103827129) is (3-cyano-4-fluorophenyl)methyl 5-amino-2-bromobenzoate.
What is the SMILES notation for (3-cyano-4-fluorophenyl)methyl 5-amino-2-bromobenzoate?
The canonical SMILES for (3-cyano-4-fluorophenyl)methyl 5-amino-2-bromobenzoate is N#Cc1cc(COC(=O)c2cc(N)ccc2Br)ccc1F.
What is the InChIKey of (3-cyano-4-fluorophenyl)methyl 5-amino-2-bromobenzoate?
The InChIKey is YNWXSYWSXLKZKQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H10BrFN2O2/c16-13-3-2-11(19)6-12(13)15(20)21-8-9-1-4-14(17)10(5-9)7-18/h1-6H,8,19H2.
What are the key properties of (3-cyano-4-fluorophenyl)methyl 5-amino-2-bromobenzoate?
(3-cyano-4-fluorophenyl)methyl 5-amino-2-bromobenzoate has a molecular weight of 349.16 g/mol, XLogP of 3.40, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3-cyano-4-fluorophenyl)methyl 5-amino-2-bromobenzoate is sourced from PubChem (CID 103827129), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).