C14H9Br2F2NO2 — CID 106269657
(3-bromo-2,6-difluorophenyl)methyl 5-amino-2-bromobenzoate (PubChem CID 106269657) has the molecular formula C14H9Br2F2NO2 and a molecular weight of 421.04 g/mol. Its IUPAC name is (3-bromo-2,6-difluorophenyl)methyl 5-amino-2-bromobenzoate.
| Compound Name | (3-bromo-2,6-difluorophenyl)methyl 5-amino-2-bromobenzoate |
|---|---|
| PubChem CID | 106269657 |
| Molecular Formula | C14H9Br2F2NO2 |
| Molecular Weight | 421.04 g/mol |
| Exact Mass | 418.90 |
| IUPAC Name | (3-bromo-2,6-difluorophenyl)methyl 5-amino-2-bromobenzoate |
| SMILES | Nc1ccc(Br)c(C(=O)OCc2c(F)ccc(Br)c2F)c1 |
| InChI | InChI=1S/C14H9Br2F2NO2/c15-10-2-1-7(19)5-8(10)14(20)21-6-9-12(17)4-3-11(16)13(9)18/h1-5H,6,19H2 |
| InChIKey | PTHKQFBFOKPVDI-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.04 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|