About 2-propoxyethyl 5-amino-2-bromobenzoate
2-propoxyethyl 5-amino-2-bromobenzoate (PubChem CID 63686907) has the molecular formula C12H16BrNO3
and a molecular weight of 302.17 g/mol. Its IUPAC name is 2-propoxyethyl 5-amino-2-bromobenzoate.
Molecular Properties
| Compound Name | 2-propoxyethyl 5-amino-2-bromobenzoate |
| PubChem CID | 63686907 |
| Molecular Formula | C12H16BrNO3 |
| Molecular Weight | 302.17 g/mol |
| Exact Mass | 301.03 |
| IUPAC Name | 2-propoxyethyl 5-amino-2-bromobenzoate |
| SMILES | CCCOCCOC(=O)c1cc(N)ccc1Br |
| InChI | InChI=1S/C12H16BrNO3/c1-2-5-16-6-7-17-12(15)10-8-9(14)3-4-11(10)13/h3-4,8H,2,5-7,14H2,1H3 |
| InChIKey | MABVTADYMNBBJJ-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.17 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-propoxyethyl 5-amino-2-bromobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-propoxyethyl 5-amino-2-bromobenzoate?
The IUPAC name of 2-propoxyethyl 5-amino-2-bromobenzoate (CID 63686907) is 2-propoxyethyl 5-amino-2-bromobenzoate.
What is the SMILES notation for 2-propoxyethyl 5-amino-2-bromobenzoate?
The canonical SMILES for 2-propoxyethyl 5-amino-2-bromobenzoate is CCCOCCOC(=O)c1cc(N)ccc1Br.
What is the InChIKey of 2-propoxyethyl 5-amino-2-bromobenzoate?
The InChIKey is MABVTADYMNBBJJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16BrNO3/c1-2-5-16-6-7-17-12(15)10-8-9(14)3-4-11(10)13/h3-4,8H,2,5-7,14H2,1H3.
What are the key properties of 2-propoxyethyl 5-amino-2-bromobenzoate?
2-propoxyethyl 5-amino-2-bromobenzoate has a molecular weight of 302.17 g/mol, XLogP of 2.61, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-propoxyethyl 5-amino-2-bromobenzoate is sourced from PubChem (CID 63686907), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).