C10H12BrNO4 — CID 82850096
2,3-dihydroxypropyl 5-amino-2-bromobenzoate (PubChem CID 82850096) has the molecular formula C10H12BrNO4 and a molecular weight of 290.11 g/mol. Its IUPAC name is 2,3-dihydroxypropyl 5-amino-2-bromobenzoate.
| Compound Name | 2,3-dihydroxypropyl 5-amino-2-bromobenzoate |
|---|---|
| PubChem CID | 82850096 |
| Molecular Formula | C10H12BrNO4 |
| Molecular Weight | 290.11 g/mol |
| Exact Mass | 288.99 |
| IUPAC Name | 2,3-dihydroxypropyl 5-amino-2-bromobenzoate |
| SMILES | Nc1ccc(Br)c(C(=O)OCC(O)CO)c1 |
| InChI | InChI=1S/C10H12BrNO4/c11-9-2-1-6(12)3-8(9)10(15)16-5-7(14)4-13/h1-3,7,13-14H,4-5,12H2 |
| InChIKey | ZSKZOFQTXJVWKP-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.11 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|