C13H19NO6 — CID 101131908
[3-(2,3-dihydroxypropoxy)-2-hydroxypropyl] 4-aminobenzoate (PubChem CID 101131908) has the molecular formula C13H19NO6 and a molecular weight of 285.30 g/mol. Its IUPAC name is [3-(2,3-dihydroxypropoxy)-2-hydroxypropyl] 4-aminobenzoate.
| Compound Name | [3-(2,3-dihydroxypropoxy)-2-hydroxypropyl] 4-aminobenzoate |
|---|---|
| PubChem CID | 101131908 |
| Molecular Formula | C13H19NO6 |
| Molecular Weight | 285.30 g/mol |
| Exact Mass | 285.12 |
| IUPAC Name | [3-(2,3-dihydroxypropoxy)-2-hydroxypropyl] 4-aminobenzoate |
| SMILES | Nc1ccc(C(=O)OCC(O)COCC(O)CO)cc1 |
| InChI | InChI=1S/C13H19NO6/c14-10-3-1-9(2-4-10)13(18)20-8-12(17)7-19-6-11(16)5-15/h1-4,11-12,15-17H,5-8,14H2 |
| InChIKey | HLAAWSRNEGNZAG-UHFFFAOYSA-N |
| XLogP | -0.84 |
| TPSA | 122.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.30 |
| LogP ≤ 5 | -0.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|