C19H26N2O4 — CID 91007608
2,3-dihydroxypropyl 4-aminobenzoate;N,N,4-trimethylaniline (PubChem CID 91007608) has the molecular formula C19H26N2O4 and a molecular weight of 346.43 g/mol. Its IUPAC name is 2,3-dihydroxypropyl 4-aminobenzoate;N,N,4-trimethylaniline.
| Compound Name | 2,3-dihydroxypropyl 4-aminobenzoate;N,N,4-trimethylaniline |
|---|---|
| PubChem CID | 91007608 |
| Molecular Formula | C19H26N2O4 |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.19 |
| IUPAC Name | 2,3-dihydroxypropyl 4-aminobenzoate;N,N,4-trimethylaniline |
| SMILES | Cc1ccc(N(C)C)cc1.Nc1ccc(C(=O)OCC(O)CO)cc1 |
| InChI | InChI=1S/C10H13NO4.C9H13N/c11-8-3-1-7(2-4-8)10(14)15-6-9(13)5-12;1-8-4-6-9(7-5-8)10(2)3/h1-4,9,12-13H,5-6,11H2;4-7H,1-3H3 |
| InChIKey | YMRNXKYDWIEFKK-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|