C60H68N6O12 — CID 156726688
2,3,4,5,6-pentakis[[4-(dimethylamino)benzoyl]oxy]hexyl 4-(dimethylamino)benzoate (PubChem CID 156726688) has the molecular formula C60H68N6O12 and a molecular weight of 1065.23 g/mol. Its IUPAC name is 2,3,4,5,6-pentakis[[4-(dimethylamino)benzoyl]oxy]hexyl 4-(dimethylamino)benzoate.
| Compound Name | 2,3,4,5,6-pentakis[[4-(dimethylamino)benzoyl]oxy]hexyl 4-(dimethylamino)benzoate |
|---|---|
| PubChem CID | 156726688 |
| Molecular Formula | C60H68N6O12 |
| Molecular Weight | 1065.23 g/mol |
| Exact Mass | 1064.49 |
| IUPAC Name | 2,3,4,5,6-pentakis[[4-(dimethylamino)benzoyl]oxy]hexyl 4-(dimethylamino)benzoate |
| SMILES | CN(C)c1ccc(C(=O)OCC(OC(=O)c2ccc(N(C)C)cc2)C(OC(=O)c2ccc(N(C)C)cc2)C(OC(=O)c2ccc(N(C)C)cc2)C(COC(=O)c2ccc(N(C)C)cc2)OC(=O)c2ccc(N(C)C)cc2)cc1 |
| InChI | InChI=1S/C60H68N6O12/c1-61(2)45-25-13-39(14-26-45)55(67)73-37-51(75-57(69)41-17-29-47(30-18-41)63(5)6)53(77-59(71)43-21-33-49(34-22-43)65(9)10)54(78-60(72)44-23-35-50(36-24-44)66(11)12)52(76-58(70)42-19-31-48(32-20-42)64(7)8)38-74-56(68)40-15-27-46(28-16-40)62(3)4/h13-36,51-54H,37-38H2,1-12H3 |
| InChIKey | WNGHPRJKHHSOPG-UHFFFAOYSA-N |
| XLogP | 8.00 |
| TPSA | 177.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 78 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1065.23 |
| LogP ≤ 5 | 8.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|