C12H14O4S3 — CID 175202185
[4-(2,3-dihydroxypropoxycarbonyl)phenyl]methylsulfanylmethanedithioic acid (PubChem CID 175202185) has the molecular formula C12H14O4S3 and a molecular weight of 318.44 g/mol. Its IUPAC name is [4-(2,3-dihydroxypropoxycarbonyl)phenyl]methylsulfanylmethanedithioic acid.
| Compound Name | [4-(2,3-dihydroxypropoxycarbonyl)phenyl]methylsulfanylmethanedithioic acid |
|---|---|
| PubChem CID | 175202185 |
| Molecular Formula | C12H14O4S3 |
| Molecular Weight | 318.44 g/mol |
| Exact Mass | 318.01 |
| IUPAC Name | [4-(2,3-dihydroxypropoxycarbonyl)phenyl]methylsulfanylmethanedithioic acid |
| SMILES | O=C(OCC(O)CO)c1ccc(CSC(=S)S)cc1 |
| InChI | InChI=1S/C12H14O4S3/c13-5-10(14)6-16-11(15)9-3-1-8(2-4-9)7-19-12(17)18/h1-4,10,13-14H,5-7H2,(H,17,18) |
| InChIKey | SUKVNRHSDOVPQZ-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.44 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|