C12H14O3S3 — CID 87163804
2-hydroxyethyl 4-(methylsulfanylcarbothioylsulfanylmethyl)benzoate (PubChem CID 87163804) has the molecular formula C12H14O3S3 and a molecular weight of 302.44 g/mol. Its IUPAC name is 2-hydroxyethyl 4-(methylsulfanylcarbothioylsulfanylmethyl)benzoate.
| Compound Name | 2-hydroxyethyl 4-(methylsulfanylcarbothioylsulfanylmethyl)benzoate |
|---|---|
| PubChem CID | 87163804 |
| Molecular Formula | C12H14O3S3 |
| Molecular Weight | 302.44 g/mol |
| Exact Mass | 302.01 |
| IUPAC Name | 2-hydroxyethyl 4-(methylsulfanylcarbothioylsulfanylmethyl)benzoate |
| SMILES | CSC(=S)SCc1ccc(C(=O)OCCO)cc1 |
| InChI | InChI=1S/C12H14O3S3/c1-17-12(16)18-8-9-2-4-10(5-3-9)11(14)15-7-6-13/h2-5,13H,6-8H2,1H3 |
| InChIKey | XKHQGOFDWCDBCW-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.44 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|