About 2-hydroxyethyl 4-(2-hydroxyethoxymethyl)benzoate
2-hydroxyethyl 4-(2-hydroxyethoxymethyl)benzoate (PubChem CID 69170087) has the molecular formula C12H16O5
and a molecular weight of 240.25 g/mol. Its IUPAC name is 2-hydroxyethyl 4-(2-hydroxyethoxymethyl)benzoate.
Molecular Properties
| Compound Name | 2-hydroxyethyl 4-(2-hydroxyethoxymethyl)benzoate |
| PubChem CID | 69170087 |
| Molecular Formula | C12H16O5 |
| Molecular Weight | 240.25 g/mol |
| Exact Mass | 240.10 |
| IUPAC Name | 2-hydroxyethyl 4-(2-hydroxyethoxymethyl)benzoate |
| SMILES | O=C(OCCO)c1ccc(COCCO)cc1 |
| InChI | InChI=1S/C12H16O5/c13-5-7-16-9-10-1-3-11(4-2-10)12(15)17-8-6-14/h1-4,13-14H,5-9H2 |
| InChIKey | OCCLPDNOPLGTSZ-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.25 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-hydroxyethyl 4-(2-hydroxyethoxymethyl)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxyethyl 4-(2-hydroxyethoxymethyl)benzoate?
The IUPAC name of 2-hydroxyethyl 4-(2-hydroxyethoxymethyl)benzoate (CID 69170087) is 2-hydroxyethyl 4-(2-hydroxyethoxymethyl)benzoate.
What is the SMILES notation for 2-hydroxyethyl 4-(2-hydroxyethoxymethyl)benzoate?
The canonical SMILES for 2-hydroxyethyl 4-(2-hydroxyethoxymethyl)benzoate is O=C(OCCO)c1ccc(COCCO)cc1.
What is the InChIKey of 2-hydroxyethyl 4-(2-hydroxyethoxymethyl)benzoate?
The InChIKey is OCCLPDNOPLGTSZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16O5/c13-5-7-16-9-10-1-3-11(4-2-10)12(15)17-8-6-14/h1-4,13-14H,5-9H2.
What are the key properties of 2-hydroxyethyl 4-(2-hydroxyethoxymethyl)benzoate?
2-hydroxyethyl 4-(2-hydroxyethoxymethyl)benzoate has a molecular weight of 240.25 g/mol, XLogP of 0.34, 7 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxyethyl 4-(2-hydroxyethoxymethyl)benzoate is sourced from PubChem (CID 69170087), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).