C24H27O14P — CID 138530108
1-O-(2-hydroxyethyl) 4-O-[2-[hydroxy-[2-[4-(2-hydroxyethoxycarbonyl)benzoyl]oxyethoxy]phosphoryl]oxyethyl] benzene-1,4-dicarboxylate (PubChem CID 138530108) has the molecular formula C24H27O14P and a molecular weight of 570.44 g/mol. Its IUPAC name is 1-O-(2-hydroxyethyl) 4-O-[2-[hydroxy-[2-[4-(2-hydroxyethoxycarbonyl)benzoyl]oxyethoxy]phosphoryl]oxyethyl] benzene-1,4-dicarboxylate.
| Compound Name | 1-O-(2-hydroxyethyl) 4-O-[2-[hydroxy-[2-[4-(2-hydroxyethoxycarbonyl)benzoyl]oxyethoxy]phosphoryl]oxyethyl] benzene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 138530108 |
| Molecular Formula | C24H27O14P |
| Molecular Weight | 570.44 g/mol |
| Exact Mass | 570.11 |
| IUPAC Name | 1-O-(2-hydroxyethyl) 4-O-[2-[hydroxy-[2-[4-(2-hydroxyethoxycarbonyl)benzoyl]oxyethoxy]phosphoryl]oxyethyl] benzene-1,4-dicarboxylate |
| SMILES | O=C(OCCO)c1ccc(C(=O)OCCOP(=O)(O)OCCOC(=O)c2ccc(C(=O)OCCO)cc2)cc1 |
| InChI | InChI=1S/C24H27O14P/c25-9-11-33-21(27)17-1-5-19(6-2-17)23(29)35-13-15-37-39(31,32)38-16-14-36-24(30)20-7-3-18(4-8-20)22(28)34-12-10-26/h1-8,25-26H,9-16H2,(H,31,32) |
| InChIKey | QFTAKILZCCAAHD-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 201.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.44 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|