C12H16N2O6 — CID 164990085
bis(2-aminooxyethyl) benzene-1,4-dicarboxylate (PubChem CID 164990085) has the molecular formula C12H16N2O6 and a molecular weight of 284.27 g/mol. Its IUPAC name is bis(2-aminooxyethyl) benzene-1,4-dicarboxylate.
| Compound Name | bis(2-aminooxyethyl) benzene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 164990085 |
| Molecular Formula | C12H16N2O6 |
| Molecular Weight | 284.27 g/mol |
| Exact Mass | 284.10 |
| IUPAC Name | bis(2-aminooxyethyl) benzene-1,4-dicarboxylate |
| SMILES | NOCCOC(=O)c1ccc(C(=O)OCCON)cc1 |
| InChI | InChI=1S/C12H16N2O6/c13-19-7-5-17-11(15)9-1-2-10(4-3-9)12(16)18-6-8-20-14/h1-4H,5-8,13-14H2 |
| InChIKey | GSOAVHBZXLGMRG-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 123.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.27 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|