C12H19O8P — CID 175442784
2-hydroxyethyl dihydrogen phosphate;propyl 4-hydroxybenzoate (PubChem CID 175442784) has the molecular formula C12H19O8P and a molecular weight of 322.25 g/mol. Its IUPAC name is 2-hydroxyethyl dihydrogen phosphate;propyl 4-hydroxybenzoate.
| Compound Name | 2-hydroxyethyl dihydrogen phosphate;propyl 4-hydroxybenzoate |
|---|---|
| PubChem CID | 175442784 |
| Molecular Formula | C12H19O8P |
| Molecular Weight | 322.25 g/mol |
| Exact Mass | 322.08 |
| IUPAC Name | 2-hydroxyethyl dihydrogen phosphate;propyl 4-hydroxybenzoate |
| SMILES | CCCOC(=O)c1ccc(O)cc1.O=P(O)(O)OCCO |
| InChI | InChI=1S/C10H12O3.C2H7O5P/c1-2-7-13-10(12)8-3-5-9(11)6-4-8;3-1-2-7-8(4,5)6/h3-6,11H,2,7H2,1H3;3H,1-2H2,(H2,4,5,6) |
| InChIKey | JJKGISMXPJWXGW-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 133.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.25 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|