About ethene;4-(2-hydroxyethoxycarbonyl)benzenecarboperoxoic acid
ethene;4-(2-hydroxyethoxycarbonyl)benzenecarboperoxoic acid (PubChem CID 161199390) has the molecular formula C12H14O6
and a molecular weight of 254.24 g/mol. Its IUPAC name is ethene;4-(2-hydroxyethoxycarbonyl)benzenecarboperoxoic acid.
Molecular Properties
| Compound Name | ethene;4-(2-hydroxyethoxycarbonyl)benzenecarboperoxoic acid |
| PubChem CID | 161199390 |
| Molecular Formula | C12H14O6 |
| Molecular Weight | 254.24 g/mol |
| Exact Mass | 254.08 |
| IUPAC Name | ethene;4-(2-hydroxyethoxycarbonyl)benzenecarboperoxoic acid |
| SMILES | C=C.O=C(OO)c1ccc(C(=O)OCCO)cc1 |
| InChI | InChI=1S/C10H10O6.C2H4/c11-5-6-15-9(12)7-1-3-8(4-2-7)10(13)16-14;1-2/h1-4,11,14H,5-6H2;1-2H2 |
| InChIKey | UUTXLCMHZDKIBC-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.24 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze ethene;4-(2-hydroxyethoxycarbonyl)benzenecarboperoxoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethene;4-(2-hydroxyethoxycarbonyl)benzenecarboperoxoic acid?
The IUPAC name of ethene;4-(2-hydroxyethoxycarbonyl)benzenecarboperoxoic acid (CID 161199390) is ethene;4-(2-hydroxyethoxycarbonyl)benzenecarboperoxoic acid.
What is the SMILES notation for ethene;4-(2-hydroxyethoxycarbonyl)benzenecarboperoxoic acid?
The canonical SMILES for ethene;4-(2-hydroxyethoxycarbonyl)benzenecarboperoxoic acid is C=C.O=C(OO)c1ccc(C(=O)OCCO)cc1.
What is the InChIKey of ethene;4-(2-hydroxyethoxycarbonyl)benzenecarboperoxoic acid?
The InChIKey is UUTXLCMHZDKIBC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10O6.C2H4/c11-5-6-15-9(12)7-1-3-8(4-2-7)10(13)16-14;1-2/h1-4,11,14H,5-6H2;1-2H2.
What are the key properties of ethene;4-(2-hydroxyethoxycarbonyl)benzenecarboperoxoic acid?
ethene;4-(2-hydroxyethoxycarbonyl)benzenecarboperoxoic acid has a molecular weight of 254.24 g/mol, XLogP of 1.27, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethene;4-(2-hydroxyethoxycarbonyl)benzenecarboperoxoic acid is sourced from PubChem (CID 161199390), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).