C19H22O8 — CID 66700398
bis(2-hydroxyethyl) benzene-1,4-dicarboxylate;3-methylbenzene-1,2-diol (PubChem CID 66700398) has the molecular formula C19H22O8 and a molecular weight of 378.38 g/mol. Its IUPAC name is bis(2-hydroxyethyl) benzene-1,4-dicarboxylate;3-methylbenzene-1,2-diol.
| Compound Name | bis(2-hydroxyethyl) benzene-1,4-dicarboxylate;3-methylbenzene-1,2-diol |
|---|---|
| PubChem CID | 66700398 |
| Molecular Formula | C19H22O8 |
| Molecular Weight | 378.38 g/mol |
| Exact Mass | 378.13 |
| IUPAC Name | bis(2-hydroxyethyl) benzene-1,4-dicarboxylate;3-methylbenzene-1,2-diol |
| SMILES | Cc1cccc(O)c1O.O=C(OCCO)c1ccc(C(=O)OCCO)cc1 |
| InChI | InChI=1S/C12H14O6.C7H8O2/c13-5-7-17-11(15)9-1-2-10(4-3-9)12(16)18-8-6-14;1-5-3-2-4-6(8)7(5)9/h1-4,13-14H,5-8H2;2-4,8-9H,1H3 |
| InChIKey | BZBHFNWBMOQOKB-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 133.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.38 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|