About sodium;3-methylbenzene-1,2-diol;chloride
sodium;3-methylbenzene-1,2-diol;chloride (PubChem CID 174915760) has the molecular formula C7H8ClNaO2
and a molecular weight of 182.58 g/mol. Its IUPAC name is sodium;3-methylbenzene-1,2-diol;chloride.
Molecular Properties
| Compound Name | sodium;3-methylbenzene-1,2-diol;chloride |
| PubChem CID | 174915760 |
| Molecular Formula | C7H8ClNaO2 |
| Molecular Weight | 182.58 g/mol |
| Exact Mass | 182.01 |
| IUPAC Name | sodium;3-methylbenzene-1,2-diol;chloride |
| SMILES | Cc1cccc(O)c1O.[Cl-].[Na+] |
| InChI | InChI=1S/C7H8O2.ClH.Na/c1-5-3-2-4-6(8)7(5)9;;/h2-4,8-9H,1H3;1H;/q;;+1/p-1 |
| InChIKey | YLGZNTWXVBMYBF-UHFFFAOYSA-M |
| XLogP | -4.59 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.58 |
| LogP ≤ 5 | -4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze sodium;3-methylbenzene-1,2-diol;chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;3-methylbenzene-1,2-diol;chloride?
The IUPAC name of sodium;3-methylbenzene-1,2-diol;chloride (CID 174915760) is sodium;3-methylbenzene-1,2-diol;chloride.
What is the SMILES notation for sodium;3-methylbenzene-1,2-diol;chloride?
The canonical SMILES for sodium;3-methylbenzene-1,2-diol;chloride is Cc1cccc(O)c1O.[Cl-].[Na+].
What is the InChIKey of sodium;3-methylbenzene-1,2-diol;chloride?
The InChIKey is YLGZNTWXVBMYBF-UHFFFAOYSA-M. The full InChI is InChI=1S/C7H8O2.ClH.Na/c1-5-3-2-4-6(8)7(5)9;;/h2-4,8-9H,1H3;1H;/q;;+1/p-1.
What are the key properties of sodium;3-methylbenzene-1,2-diol;chloride?
sodium;3-methylbenzene-1,2-diol;chloride has a molecular weight of 182.58 g/mol, XLogP of -4.59, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;3-methylbenzene-1,2-diol;chloride is sourced from PubChem (CID 174915760), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).