C14H16O4 — CID 135381405
3-methylbenzene-1,2-diol (PubChem CID 135381405) has the molecular formula C14H16O4 and a molecular weight of 248.28 g/mol. Its IUPAC name is 3-methylbenzene-1,2-diol.
| Compound Name | 3-methylbenzene-1,2-diol |
|---|---|
| PubChem CID | 135381405 |
| Molecular Formula | C14H16O4 |
| Molecular Weight | 248.28 g/mol |
| Exact Mass | 248.10 |
| IUPAC Name | 3-methylbenzene-1,2-diol |
| SMILES | Cc1cccc(O)c1O.Cc1cccc(O)c1O |
| InChI | InChI=1S/2C7H8O2/c2*1-5-3-2-4-6(8)7(5)9/h2*2-4,8-9H,1H3 |
| InChIKey | HJIYOFNCHBQOQL-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.28 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|