About ethanol;2-hydroxyethyl 4-(oxomethyl)benzoate;uranium(2+)
ethanol;2-hydroxyethyl 4-(oxomethyl)benzoate;uranium(2+) (PubChem CID 164874748) has the molecular formula C12H14O5U
and a molecular weight of 476.27 g/mol. Its IUPAC name is ethanol;2-hydroxyethyl 4-(oxomethyl)benzoate;uranium(2+).
Molecular Properties
| Compound Name | ethanol;2-hydroxyethyl 4-(oxomethyl)benzoate;uranium(2+) |
| PubChem CID | 164874748 |
| Molecular Formula | C12H14O5U |
| Molecular Weight | 476.27 g/mol |
| Exact Mass | 476.13 |
| IUPAC Name | ethanol;2-hydroxyethyl 4-(oxomethyl)benzoate;uranium(2+) |
| SMILES | O=[C-]c1ccc(C(=O)OCCO)cc1.[CH2-]CO.[U+2] |
| InChI | InChI=1S/C10H9O4.C2H5O.U/c11-5-6-14-10(13)9-3-1-8(7-12)2-4-9;1-2-3;/h1-4,11H,5-6H2;3H,1-2H2;/q2*-1;+2 |
| InChIKey | SVTDRNFANDTQMZ-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 476.27 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze ethanol;2-hydroxyethyl 4-(oxomethyl)benzoate;uranium(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethanol;2-hydroxyethyl 4-(oxomethyl)benzoate;uranium(2+)?
The IUPAC name of ethanol;2-hydroxyethyl 4-(oxomethyl)benzoate;uranium(2+) (CID 164874748) is ethanol;2-hydroxyethyl 4-(oxomethyl)benzoate;uranium(2+).
What is the SMILES notation for ethanol;2-hydroxyethyl 4-(oxomethyl)benzoate;uranium(2+)?
The canonical SMILES for ethanol;2-hydroxyethyl 4-(oxomethyl)benzoate;uranium(2+) is O=[C-]c1ccc(C(=O)OCCO)cc1.[CH2-]CO.[U+2].
What is the InChIKey of ethanol;2-hydroxyethyl 4-(oxomethyl)benzoate;uranium(2+)?
The InChIKey is SVTDRNFANDTQMZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9O4.C2H5O.U/c11-5-6-14-10(13)9-3-1-8(7-12)2-4-9;1-2-3;/h1-4,11H,5-6H2;3H,1-2H2;/q2*-1;+2.
What are the key properties of ethanol;2-hydroxyethyl 4-(oxomethyl)benzoate;uranium(2+)?
ethanol;2-hydroxyethyl 4-(oxomethyl)benzoate;uranium(2+) has a molecular weight of 476.27 g/mol, XLogP of 0.11, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethanol;2-hydroxyethyl 4-(oxomethyl)benzoate;uranium(2+) is sourced from PubChem (CID 164874748), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).