C25H32N2O2S3 — CID 142281085
4-[[4-(diethylcarbamoyl)phenyl]methylsulfanylcarbothioylsulfanylmethyl]-N,N-diethylbenzamide (PubChem CID 142281085) has the molecular formula C25H32N2O2S3 and a molecular weight of 488.74 g/mol. Its IUPAC name is 4-[[4-(diethylcarbamoyl)phenyl]methylsulfanylcarbothioylsulfanylmethyl]-N,N-diethylbenzamide.
| Compound Name | 4-[[4-(diethylcarbamoyl)phenyl]methylsulfanylcarbothioylsulfanylmethyl]-N,N-diethylbenzamide |
|---|---|
| PubChem CID | 142281085 |
| Molecular Formula | C25H32N2O2S3 |
| Molecular Weight | 488.74 g/mol |
| Exact Mass | 488.16 |
| IUPAC Name | 4-[[4-(diethylcarbamoyl)phenyl]methylsulfanylcarbothioylsulfanylmethyl]-N,N-diethylbenzamide |
| SMILES | CCN(CC)C(=O)c1ccc(CSC(=S)SCc2ccc(C(=O)N(CC)CC)cc2)cc1 |
| InChI | InChI=1S/C25H32N2O2S3/c1-5-26(6-2)23(28)21-13-9-19(10-14-21)17-31-25(30)32-18-20-11-15-22(16-12-20)24(29)27(7-3)8-4/h9-16H,5-8,17-18H2,1-4H3 |
| InChIKey | UYUDWYRKQCOYKL-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.74 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|