C13H19NOS2 — CID 110005187
[4-(hydroxymethyl)phenyl]methyl N,N-diethylcarbamodithioate (PubChem CID 110005187) has the molecular formula C13H19NOS2 and a molecular weight of 269.44 g/mol. Its IUPAC name is [4-(hydroxymethyl)phenyl]methyl N,N-diethylcarbamodithioate.
| Compound Name | [4-(hydroxymethyl)phenyl]methyl N,N-diethylcarbamodithioate |
|---|---|
| PubChem CID | 110005187 |
| Molecular Formula | C13H19NOS2 |
| Molecular Weight | 269.44 g/mol |
| Exact Mass | 269.09 |
| IUPAC Name | [4-(hydroxymethyl)phenyl]methyl N,N-diethylcarbamodithioate |
| SMILES | CCN(CC)C(=S)SCc1ccc(CO)cc1 |
| InChI | InChI=1S/C13H19NOS2/c1-3-14(4-2)13(16)17-10-12-7-5-11(9-15)6-8-12/h5-8,15H,3-4,9-10H2,1-2H3 |
| InChIKey | HEYGDZSOALSRTR-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.44 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|