C23H39NS2 — CID 19910003
(4-methylphenyl)methyl N,N-diheptylcarbamodithioate (PubChem CID 19910003) has the molecular formula C23H39NS2 and a molecular weight of 393.71 g/mol. Its IUPAC name is (4-methylphenyl)methyl N,N-diheptylcarbamodithioate.
| Compound Name | (4-methylphenyl)methyl N,N-diheptylcarbamodithioate |
|---|---|
| PubChem CID | 19910003 |
| Molecular Formula | C23H39NS2 |
| Molecular Weight | 393.71 g/mol |
| Exact Mass | 393.25 |
| IUPAC Name | (4-methylphenyl)methyl N,N-diheptylcarbamodithioate |
| SMILES | CCCCCCCN(CCCCCCC)C(=S)SCc1ccc(C)cc1 |
| InChI | InChI=1S/C23H39NS2/c1-4-6-8-10-12-18-24(19-13-11-9-7-5-2)23(25)26-20-22-16-14-21(3)15-17-22/h14-17H,4-13,18-20H2,1-3H3 |
| InChIKey | CGLNPTOOSIWHKK-UHFFFAOYSA-N |
| XLogP | 7.76 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.71 |
| LogP ≤ 5 | 7.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|